Prostaglandin F2α ethanolamide | MedChemExpress (MCE)
Prostaglandin F2α ethanolamide (Prostamide F2α) is an ethanolamide-like G protein-coupled receptor. Prostaglandin F2α is also a luteinizing hormone in sheep and may be a nociceptive mediator in the spinal cord[1][2][3].
| Trivial name | Prostaglandin F2α ethanolamide |
| Catalog Number | HY-130660 |
| Alternative Name(s) | Prostamide F2α |
| Research Area | Endocrinology |
| CAS# | 353787-70-9 |
| Purity | ≥98.0% |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@H]([C@H](C[C@H]1O)O)C/C=C\CCCC(NCCO)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/prostaglandin-f2α-ethanolamide.html |
