ABT 492 meglumine 50mg
ABT 492 was more potent against quinolone-susceptible and -resistant gram-positive organisms, had activity similar to that of ciprofloxacin against certain members of the family Enterobacteriaceae, and had comparable activity against quinolone-susceptible, nonfermentative, gram-negative organisms. in vitro:
| Trivial name | ABT 492 meglumine 50mg |
| Catalog Number | A15064-50 |
| Alternative Name(s) | 1-(6-amino-3,5-difluoropyridin-2-yl)-8-chloro-6-fluoro-7-(3-hydroxyazetidin-1-yl)-4-oxoquinoline-3-carboxylic acid |
| Molecular Formula | C25H29ClF3N5O9 |
| CAS# | 352458-37-8 |
| SMILES | CNCC(C(C(C(CO)O)O)O)O.C1C(CN1C2=C(C=C3C(=C2Cl)N(C=C(C3=O)C(=O)O)C4=NC(=C(C=C4F)F)N)F)O |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/abt-492-meglumine.html |
