Estradiol Sulphate D4 sodium
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02830 |
| Alternative Name(s) | sodium (1S,10R,11S,14S,15S)-14-hydroxy-15-methyl(4,6,13,13-2H4)tetracyclo[8.7.0.02,7.011,15]heptadeca-2,4,6-trien-5-yl sulfate; Sodium 17 β-Estradiol 3-Sulfate D4 |
| Research Area | Labeled Estradiol, intended for use as an internal standard for the quantification of Estradiol by GC- or LC-mass spectrometry. |
| Molecular Formula | C18H19D4O5SNa |
| CAS# | 352431-50-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@]1([C@H]2O)[C@](CC2([2H])[2H])([H])[C@@](CCC3=C4[2H])([H])[C@](C3=CC([2H])=C4O[S](=O)(O)=O)([H])CC1.[NaH] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02830.html |
| Additional Information | NULL |