Sulforhodamine B sodium salt
Sulforhodamine B (SRB, Acid Red 52, Kiton Red 620) sodium salt is a protein-specific fluorescent dye that is utilized to quantitate cell expansion, growth, and migration.
| Trivial name | SRB, Acid Red 52, Kiton Red 620 |
| Catalog Number | S5976 |
| Molecular Formula | C27H29N2NaO7S2 |
| CAS# | 3520-42-1 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | [Na+].CCN(CC)C1=CC2=C(C=C1)C(=C3C=CC(C=C3O2)=[N+](CC)CC)C4=C(C=C(C=C4)[S]([O-])(=O)=O)[S]([O-])(=O)=O |
| Size | 200mg |
| Supplier Page | http://www.selleckchem.com/products/sulforhodamine-b-sodium-salt.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s5976-sulforhodamine-b-sodium-salt-chemical-structure.gif |