Hydroxy Ipronidazole
Marine
| Trivial name | NULL |
| Catalog Number | CS-W-00168 |
| Alternative Name(s) | 2-(1-methyl-5-nitro-1H-imidazol-2-yl)propan-2-ol; 1-Methyl-2-(2?-hydroxyisopropyl)- 5-nitroimidazole |
| Research Area | The metabolite of Ipronidazole . |
| Molecular Formula | C7H11N3O3 |
| CAS# | 35175-14-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CN1C(C(C)(O)C)=NC=C1[N](=O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSW00168.html |
| Additional Information | NULL |