OGG1 Inhibitor O8
O8 OGG1 Inhibitor is an inhibitor of OGG1 with IC50 value of 0.35μM in fluorescence-based OGG1 assays. It can inhibit Schiff base formation during OGG1-mediated catalysis but did not reduce DNA binding of OGG1 to a 7,8-dihydro-8-oxoguanine (8-oxo-Gua)-containing substrate.
| Trivial name | / |
| Catalog Number | CSN25635 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C9H6Cl2N2OS |
| CAS# | 350997-39-6 |
| Purity | ≥99% |
| SMILES | O=C(C1=C(Cl)C2=C(Cl)C=CC=C2S1)NN |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/ogg1-inhibitor-o8.html |