Kynurenic Acid D5
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-T-57046 |
| Alternative Name(s) | 4-Hydroxyquinaldic Acid-D5;4-hydroxy(D5)quinoline-2-carboxylic acid;CS-P-01082 |
| Research Area | A labelled product of L-Tryptophan metabolism, possessing neruoactive activity having antiexcitotoxic and anticonvulsant properties. |
| Molecular Formula | C10H2D5NO3 |
| CAS# | 350820-13-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C(C([2H])=C1[2H])=C(C([2H])=C1[2H])N=C2C(O)=O)=C2[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST57046.html |
| Additional Information | NULL |