Laminaribiose | MedChemExpress (MCE)
Laminaribiose is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
| Trivial name | Laminaribiose |
| Catalog Number | HY-W145496 |
| Alternative Name(s) | β-D-Glc-(1-3)-D-Glc |
| Research Area | Others |
| CAS# | 34980-39-7 |
| Purity | ≥98.00% |
| SMILES | OC[C@@H](O)[C@@H](O)[C@@H]([C@@H](O)C=O)O[C@@H]1O[C@@H]([C@H]([C@@H]([C@H]1O)O)O)CO |
| PubChem Chemical Structure ID | 122350 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/laminaribiose.html |