HC-030031 10mM * 1mL in DMSO
HC-030031 is a selective TRPA1 blocker, antagonizing TRPA1-mediated calcium influx induced by AITC and formalin (IC50 = 6.2 and 5.3 uM, respectively).
| Trivial name | HC-030031 10mM * 1mL in DMSO |
| Catalog Number | A13278-10mM-D |
| Alternative Name(s) | 1,?2,?3,?6-?tetrahydro-?1,?3-?dimethyl-?N-?[4-?(1-?methylethyl)phenyl]-?2,?6-?dioxo-?7H-?purine-?7-?acetamide |
| Molecular Formula | C18H21N5O3 |
| CAS# | 349085-38-7 |
| SMILES | CC(C)C1=CC=C(C=C1)NC(=O)CN2C=NC3=C2C(=O)N(C(=O)N3C)C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/hc-030031.html |