Nicotinamide D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02999 |
| Alternative Name(s) | Ncotinamide-2,4,5,6-d4 |
| Research Area | Labelled Nicotinamide, precursor of the coenzymes NAD and NADP. Nicotinamide is a water soluble vitamin (enzyme cofactor).;Labeled Nicotinamide, intended for use as an internal standard for the quantification of Nicotinamide by GC- or LC-mass spectrometry. |
| Molecular Formula | C6H2D4N2O |
| CAS# | 347841-88-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | NC(C(C([2H])=C1[2H])=C(N=C1[2H])[2H])=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02999.html |
| Additional Information | NULL |