Paraquat-d8 Dichloride
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-T-60151 |
| Alternative Name(s) | 1-methyl-4-[1-methyl(H)pyridin-1-ium-4-yl](H)pyridin-1-ium methane tetrachloride |
| Research Area | Labelled Paraquat Dichloride, a commonly used heribicide. Paraquat Dichloride is a fast-acting and non-selective viologen derivative that kills green plant tissue on contact. Studies suggest that there might be a possible link between Paraquat Dichloride and the development of Parkinson's disease. |
| Molecular Formula | C12H6D8Cl2N2 |
| CAS# | 347841-45-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[N+](C([2H])=C1[2H])=C(C([2H])=C1C(C([2H])=C2[2H])=C(C([2H])=[N+]2C)[2H])[2H].[Cl-].[Cl-] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST60151.html |
| Additional Information | NULL |