ITX3
ITX3 is a specific and nontoxic inhibitor of the TrioN (N-terminal GEF domain of the multidomain Trio protein) with IC50 of 76 μM and inhibits TrioN-stimulated RhoG exchange in vitro.
| Trivial name | / |
| Catalog Number | CSN16626 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C22H17N3OS |
| CAS# | 347323-96-0 |
| Purity | ≥98% |
| SMILES | O=C1N2C(S/C1=C\C3=C(C)N(C4=CC=CC=C4)C(C)=C3)=NC5=CC=CC=C52 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/itx3.html |