Taurocholic acid sodium salt hydrate
Taurocholic acid (Sodium taurocholate hydrate), a bile salt formed in the liver, is the product of conjugation of cholic acid with taurine that is involved in the emulsification of lipids. Its sodium salt is the chief ingredient of the bile of carnivorous animals.
| Trivial name | Sodium taurocholate hydrate |
| Catalog Number | S5130 |
| Molecular Formula | C26H45NO7S.xH2O.Na |
| CAS# | 345909-26-4 |
| SMILES | CC(CCC(=O)NCCS(=O)(=O)[O-])C1CCC2C1(C(CC3C2C(CC4C3(CCC(C4)O)C)O)O)C.O.[Na+] |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/taurocholic-acid-sodium-salt-hydrate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/taurocholic-acid-sodium-salt-hydrate-chemical-structure-s5130.gif |