Ketotifen Fumarate
Antihistamines, a potent anti-metamorphic agent with both tricyclic and piperidine structures, are characterized by both strong antagonism of histamine H1 receptors and inhibition of the release of allergic response mediators.
| Catalog Number | API34580148 |
| Alternative Name(s) | Zaditen Zaditor Ketotifen hydrogen fumarate |
| Research Area | Antihistamine APIs |
| Molecular Formula | C23H23NO5S |
| CAS# | 34580-14-8 |
| SMILES | CN1CCC(=C2C3=C(C(=O)CC4=CC=CC=C42)SC=C3)CC1.C(=CC(=O)O)C(=O)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/ketotifen-fumarate-item-11602.html |