Ketotifen Fumarate
Histamine H1 receptor antagonist Neuroscience|Histamine Receptor
| Catalog Number | B1562-50 |
| Research Area | Neuroscience|Histamine Receptor |
| Molecular Formula | C23H23NO5S |
| CAS# | 34580-14-8 |
| Purity | 99.31% |
| SMILES | CN1CCC(=C2C3=C(C(=O)CC4=CC=CC=C42)SC=C3)CC1.C(=CC(=O)O)C(=O)O |
| Size | 50mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B1562 |
