SNS-032 (BMS-387032) 10mM * 1mL in DMSO
SNS-032 (BMS-387032) is a highly selective and potent inhibitor of cyclin-dependent kinases (Cdks) 2, 7, and 9, with in vitro growth inhibitory effects and ability to induce apoptosis in malignant B cells.
Trivial name | SNS-032 (BMS-387032) 10mM * 1mL in DMSO |
Catalog Number | A10850-10mM-D |
Alternative Name(s) | N-[5-[[[5-(1,1-Dimethylethyl)-2-oxazolyl]methyl]thio]-2-thiazolyl]-4-piperidinecarboxamide |
Molecular Formula | C17H24N4O2S2 |
CAS# | 345627-80-7 |
SMILES | CC(C)(C)C1=CN=C(O1)CSC2=CN=C(S2)NC(=O)C3CCNCC3 |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/sns-032-bms-387032.html |