Histamine-α,α,-β,-β-d4 Dihydrochloride
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-T-55663 |
| Alternative Name(s) | 2-[(1,2,5-²H₃)-1H-imidazol-4-yl](1-²H₁)ethan-1-amine dihydrochloride |
| Research Area | A labelled Histamine. Present in most mammalian tissues; primarily stored in mast cells and basophils. Exhibits multiple biological effects through at least 3 specific receptors. Induces bronchoconstriction and vasodilation; stimulates gastric acid secretion; and acts as a neurotransmitter. |
| Molecular Formula | C5H7D4Cl2N3 |
| CAS# | 344299-48-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | NC([2H])([2H])C([2H])([2H])C1=CN=CN1.Cl.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST55663.html |
| Additional Information | NULL |