1,2-Didecanoyl PC | MedChemExpress (MCE)
1,2-Didecanoyl PC (1,2-Didecanoyl-sn-glycero-3-phosphocholine) is a phosphocholine that can be introduced into single-chain mean field theory as a coarse-grained model of saturated phospholipids. The 1,2-Didecanoyl PC model can be used to estimate the free energy of compressive or tensile bilayers in stacks or multilayers and gives a reasonable estimate of the free energy[1].
| Trivial name | 1,2-Didecanoyl PC |
| Catalog Number | HY-131640 |
| Alternative Name(s) | 1,2-Didecanoyl-sn-glycero-3-phosphocholine |
| Research Area | Others |
| CAS# | 3436-44-0 |
| Purity | ≥98.0% |
| SMILES | C[N+](C)(C)CCOP(OC[C@H](OC(CCCCCCCCC)=O)COC(CCCCCCCCC)=O)([O-])=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/1-2-didecanoyl-pc.html |