Telbivudine
Telbivudine selectively inhibits hepatitis B virus (HBV) reverse transcriptase and is used in the treatment of hepatitis B infection.
| Trivial name | Epavudine; L-Thymidine; NV 02 B |
| Catalog Number | CSN18777 |
| Alternative Name(s) | Epavudine; L-Thymidine; NV 02 B |
| Research Area | Infection |
| Molecular Formula | C10H14N2O5 |
| CAS# | 3424-98-4 |
| Purity | ≥99% |
| SMILES | O=C1NC(C(C)=CN1[C@@H]2O[C@@H](CO)[C@H](O)C2)=O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/telbivudine.html |