Telbivudine
Telbivudine selectively inhibits hepatitis B virus (HBV) reverse transcriptase and is used in the treatment of hepatitis B infection.
Trivial name | Epavudine; L-Thymidine; NV 02 B |
Catalog Number | CSN18777 |
Alternative Name(s) | Epavudine; L-Thymidine; NV 02 B |
Research Area | Infection |
Molecular Formula | C10H14N2O5 |
CAS# | 3424-98-4 |
Purity | ≥99% |
SMILES | O=C1NC(C(C)=CN1[C@@H]2O[C@@H](CO)[C@H](O)C2)=O |
Size | 100mg |
Supplier Page | https://www.csnpharm.com/products/telbivudine.html |