(-)-Coclaurine hydrochloride | MedChemExpress (MCE)
(-)-Coclaurine hydrochloride (compound I) is a class of tetrahydroisoquinoline alkaloids that can be isolated from Sarcopetalum harveyanum. (-)-Coclaurine hydrochloride is a nicotinic acetylcholine receptor (nAChRs) antagonist[1].
| Trivial name | (-)-Coclaurine hydrochloride |
| Catalog Number | HY-W705106 |
| Alternative Name(s) | (-)-(S)-Coclaurine hydrochloride; (S)-Coclaurine hydrochloride; l-Coclaurine hydrochloride |
| Research Area | Neurological Disease |
| CAS# | 3422-42-2 |
| Purity | ≥98.00% |
| SMILES | COC1=C(O)C=C2C(CCN[C@H]2CC3=CC=C(O)C=C3)=C1.Cl |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/minus-coclaurine-hydrochloride.html |