Flavokawain A
Flavokawain A, a natural product isolated and purified from the roots of Piper methysticum with anti-tumor and anti-inflammatory activities, can significantly reduce the expression of CDK1-inhibitory kinases, Myt1 and Wee1, and cause cyclin B1 protein accumulation leading to CDK1 activation in T24 cells.
Trivial name | Flavokawain-A |
Catalog Number | CSN18812 |
Alternative Name(s) | Flavokawain-A |
Research Area | / |
Molecular Formula | C18H18O5 |
CAS# | 3420-72-2 |
Purity | ≥98% |
SMILES | O=C(C1=C(OC)C=C(OC)C=C1O)/C=C/C2=CC=C(OC)C=C2 |
Size | 5g |
Supplier Page | https://www.csnpharm.com/products/flavokawain-a.html |