Pterosin B
Pterosin B is a natural product isolated and purified from the aerial parts of Pteris semipinnata, is a salt-inducible kinase 3 (Sik3) pathway inhibitor, preventing chondrocyte hypertrophy and osteoarthritis in mice by inhibiting Sik3.
Trivial name | Pterosin-B |
Catalog Number | CSN14948 |
Alternative Name(s) | Pterosin-B |
Research Area | Immunology/Inflammation |
Molecular Formula | C14H18O2 |
CAS# | 34175-96-7 |
Purity | ≥98% |
SMILES | O=C1[C@H](C)CC2=C1C(C)=C(CCO)C(C)=C2 |
Size | 1mg |
Supplier Page | https://www.csnpharm.com/products/pterosin-b.html |