Sunitinib Malate
Sunitinib Malate is a multi-targeted RTK inhibitor targeting VEGFR2 (Flk-1) and PDGFRβ with IC50 of 80 nM and 2 nM, and also inhibits c-Kit.
| Trivial name | SU-11248 Malate |
| Catalog Number | CSN12411 |
| Alternative Name(s) | SU-11248 Malate |
| Research Area | Cancer |
| Molecular Formula | C26H33FN4O7 |
| CAS# | 341031-54-7 |
| Purity | ≥99% |
| SMILES | O=C(C1=C(C)NC(/C=C2C(NC3=C\2C=C(F)C=C3)=O)=C1C)NCCN(CC)CC.O=C(O)[C@@H](O)CC(O)=O |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/sunitinib-malate.html |
