7-O-Methylbiochanin A
7-O-Methylbiochanin A is an isoflavone derivative that can be isolated from the roots of Lotus polyphyllos and other plants of the water lily family.
| Catalog Number | TN1333 |
| Alternative Name(s) | 4',7-Dimethoxy-5-hydroxyisoflavone |
| Molecular Formula | C17H14O5 |
| CAS# | 34086-51-6 |
| Purity | 98.84% |
| SMILES | O=C1C(=COC=2C=C(OC)C=C(O)C21)C=3C=CC(OC)=CC3 |
| Size | 25 mg |
| Supplier Page | https://www.targetmol.com/compound/7-O-Methylbiochanin A |
| Additional Information | https://www.targetmol.com/datasheet/TN1333 |