Triacetonamine HCl
Triacetonamine HCl is a natural product isolated and purified from the senescing flag leaves of the barley varieties Lomerit and Carina and an anticancer chemotherapeutic agent.
| Trivial name | / |
| Catalog Number | CSN18691 |
| Alternative Name(s) | / |
| Research Area | Cancer |
| Molecular Formula | C9H18ClNO |
| CAS# | 33973-59-0 |
| Purity | ≥98% |
| SMILES | O=C1CC(C)(C)NC(C)(C)C1.[H]Cl |
| Size | 5g |
| Supplier Page | https://www.csnpharm.com/products/triacetonamine-hcl.html |
