RCM-1
RCM-1 is a nontoxic inhibitor of Forkhead box M1 (FOXM1) that suppresses goblet cell metaplasia and prevents IL-13 and STAT6 signaling in allergen-exposed mice. RCM-1 decreases carcinogenesis and nuclear β-catenin.
| Trivial name | Robert Costa Memorial drug-1 |
| Catalog Number | S6898 |
| Molecular Formula | C20H12N2OS4 |
| CAS# | 339163-65-4 |
| SMILES | O=C(CSC1=C(C#N)C(=CC(=N1)C2=CC=CS2)C3=CC=CS3)C4=CC=CS4 |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/rcm-1.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s6898-rcm-1-chemical-structure.gif |