Mdivi-1 10mM * 1mL in DMSO
Mdivi-1 is a selective cell-permeable inhibitor of mitochondrial division DRP1 (dynamin-related GTPase) and mitochondrial division Dynamin I (Dnm1) with IC50 of 1-10 ??M.
| Trivial name | Mdivi-1 10mM * 1mL in DMSO |
| Catalog Number | A14316-10mM-D |
| Alternative Name(s) | 4(1H)-Quinazolinone, 3-(2,4-dichloro-5-methoxyphenyl)-2,3-dihydro-2-thioxo- |
| Molecular Formula | C15H10Cl2N2O2S |
| CAS# | 338967-87-6 |
| SMILES | COC1=C(C=C(C(=C1)N2C(=O)C3=CC=CC=C3NC2=S)Cl)Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/mdivi-1.html |