Silychristin
Silychristin, a natural product isolated and purified from the herbs of Silybum marianum (L.) Gaertn., is a plant growth regulator, an anti-hepatotoxic agent, and an inhibitor of horseradish peroxidases and lipoxygenase.
| Trivial name | / |
| Catalog Number | CSN19967 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C16H20N2O3 |
| CAS# | 33889-69-9 |
| Purity | ≥98% |
| SMILES | O=C1[C@H](O)[C@@H](C2=CC(O)=C(O[C@@H](C3=CC=C(O)C(OC)=C3)[C@@H]4CO)C4=C2)OC5=C1C(O)=CC(O)=C5 |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/silychristin.html |