Isofangchinoline
Isofangchinoline is a bisbenzyltetrahydroisoquinoline alkaloid isolated from Stephania tetrandra, which may be an inactivator of nuclear NR4A1, as well as inhibited cell proliferation and induced apoptosis in human pancreatic cancer cells.
| Trivial name | Fangchinoline |
| Catalog Number | CSN19987 |
| Alternative Name(s) | Fangchinoline |
| Research Area | / |
| Molecular Formula | C37H40N2O6 |
| CAS# | 33889-68-8 |
| Purity | ≥99% |
| SMILES | OC1=C(C2=C(C=C1OC)CCN(C)[C@@]2(C3)[H])OC4=CC5=C(C=C4OC)CCN(C)[C@]5(CC6=CC=C(OC7=CC3=CC=C7OC)C=C6)[H] |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/isofangchinoline.html |
