Disodium uridine-5-monophosphate
Disodium uridine-5-monophosphate, a pyrimidine mononucleotide, can be converted to UTP. It has been used to study the effect of nucleotides on growth of specific intestinal bacteria.
| Trivial name | / |
| Catalog Number | CSN23370 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C9H11N2Na2O9P |
| CAS# | 3387-36-8 |
| Purity | ≥98% |
| SMILES | O=P([O-])([O-])OC[C@H]1O[C@@H](N(C(N2)=O)C=CC2=O)[C@H](O)[C@@H]1O.[Na+].[Na+] |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/disodium-uridine-5-monophosphate.html |