BIM5078 | MedChemExpress (MCE)
BIM5078 is a hepatocyte nuclear factor 4α (HNF4α) antagonist that can inhibit the expression of known HNF4α target genes. BIM5078 represses insulin promoter activity through HNF4α antagonism. BIM5078 can be used for the research of cancer and diabetes[1].
| Trivial name | BIM5078 |
| Catalog Number | HY-119971 |
| Research Area | Metabolic Disease; Cancer |
| CAS# | 337506-43-1 |
| Purity | ≥98.0% |
| SMILES | [O-][N+](C1=CC=C(C(S(=O)(N2C3=C(N=C2C)C=CC=C3)=O)=C1)Cl)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/bim5078.html |