Pachypodol
Pachypodol, a natural product isolated and purified from the leaves of Calycopteris floribunda Lam., is the most active compound on ATP synthesis inhibition and inhibits the water-splitting enzyme activity.
| Trivial name | / |
| Catalog Number | CSN14051 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C18H16O7 |
| CAS# | 33708-72-4 |
| Purity | ≥98% |
| SMILES | O=C1C(OC)=C(C2=CC=C(O)C(OC)=C2)OC3=CC(OC)=CC(O)=C13 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/pachypodol.html |