Secnidazole
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-02361 |
| Alternative Name(s) | 1-(2-methyl-5-nitro-1H-imidazol-1-yl)propan-2-ol |
| Research Area | Secnidazole is a nitroimidazole anti-infective. Effectiveness in the treatment of dientamoebiasis has been reported.[1] It has also been tested against Atopobium vaginae |
| Molecular Formula | C7H11N3O3 |
| CAS# | 3366-95-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(O)CN1C([N+]([O-])=O)=CN=C1C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02361.html |
| Additional Information | NULL |