Esketamine
API Standard
Catalog Number | CS-O-01445 |
Alternative Name(s) | (S)-2-(2-chlorophenyl)-2-(methylamino)cyclohexanone |
Research Area | It is the S(+) enantiomer of the drug ketamine, a general anaesthetic. Esketamine acts primarily as a non-competitive NMDA receptor antagonist, but is also a dopamine reuptake inhibitor. |
Molecular Formula | C13H16ClNO |
CAS# | 33643-46-8 |
Purity | >98% |
SMILES | CN[C@@](CCCC1)(C(C=CC=C2)=C2Cl)C1=O |
Size | 500 g |
Supplier Page | https://www.clearsynth.com/en/CSO01445.html |