Ispinesib 10mg
Ispinesib (SB-715992) is a potent inhibitor of kinesin spindle protein, a kinesin motor protein essential for the formation of a bipolar mitotic spindle and cell cycle progression through mitosis.
Trivial name | Ispinesib 10mg |
Catalog Number | A10486-10 |
Alternative Name(s) | (R)-N-(3-aminopropyl)-N-(1-(3-benzyl-7-chloro-4-oxo-3,4-dihydroquinazolin-2-yl)-2-methylpropyl)-4-methylbenzamide |
Molecular Formula | C30H33ClN4O2 |
CAS# | 336113-53-2 |
SMILES | CC1=CC=C(C=C1)C(=O)N(CCCN)[C@@H](C2=NC3=C(C=CC(=C3)Cl)C(=O)N2CC4=CC=CC=C4)C(C)C |
Size | 10mg |
Supplier Page | http://www.adooq.com/ispinesib-sb-715992.html |