Myricanol
Myricanol, a natural product isolated and purified from the root bark of Myrica cerifera L., can elicit growth inhibitory and cytotoxic effects on lung cancer cells and can significantly decelerate tumor growth in vivo by inducing apoptosis.
| Trivial name | / |
| Catalog Number | CSN14408 |
| Alternative Name(s) | / |
| Research Area | Cancer |
| Molecular Formula | C21H26O5 |
| CAS# | 33606-81-4 |
| Purity | ≥98% |
| SMILES | COC(C1=C2)=C(OC)C(O)=C2CCCC[C@@H](O)CCC3=CC=C(O)C1=C3 |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/myricanol.html |