DL-Sulforaphane N-acetyl-L-cysteine | MedChemExpress (MCE)
DL-Sulforaphane N-acetyl-L-cysteine (SFN-NAC) is an orally active HDAC inhibitor and metabolite of sulforaphane (HY-13755) with longer half-life and better blood-brain barrier permeability. DL-Sulforaphane N-acetyl-L-cysteine activates autophagy-mediated downregulation of α-tubulin expression through the ERK pathway and can be used in cancer research[1][2].
| Trivial name | DL-Sulforaphane N-acetyl-L-cysteine |
| Catalog Number | HY-132242 |
| Alternative Name(s) | SFN-NAC |
| Research Area | Cancer |
| CAS# | 334829-66-2 |
| Purity | ≥98.0% |
| SMILES | CS(CCCCNC(SC[C@@H](C(O)=O)NC(C)=O)=S)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/dl-sulforaphane-n-acetyl-l-cysteine.html |