Etoposide D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-13288 |
| Alternative Name(s) | NULL |
| Research Area | Labeled Etoposide, intended for use as an internal standard for the quantification of Etoposide by GC- or LC-mass spectrometry. |
| Molecular Formula | C29H29D3O13 |
| CAS# | 33419-42-0 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1[C@]2([H])[C@H](C3=CC(OC([2H])([2H])[2H])=C(O)C(OC)=C3)C4=CC(OCO5)=C5C=C4[C@@H](O[C@]6([H])O[C@@](CO[C@@H](C)O7)([H])[C@]7([H])[C@H](O)[C@H]6O)[C@@]2([H])CO1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO13288.html |
| Additional Information | NULL |