Etoposide (VP-16) 10mM * 1mL in DMSO
Etoposide forms a ternary complex with DNA and the topoisomerase II enzyme (which aids in DNA unwinding), prevents re-ligation of the DNA strands, and by doing so causes DNA strands to break. Therefore, this causes errors in DNA synthesis and promotes apoptosis of the cancer cell.
Trivial name | Etoposide (VP-16) 10mM * 1mL in DMSO |
Catalog Number | A10373-10mM-D |
Alternative Name(s) | 4'-demethyl-epipodophyllotoxin 9-[4,6-O-(R)-ethylidene-beta-D-glucopyranoside], 4' -(dihydrogen phosphate) |
Molecular Formula | C29H32O13 |
CAS# | 33419-42-0 |
SMILES | C[C@@H]1OC[C@@H]2[C@@H](O1)[C@@H]([C@H]([C@@H](O2)O[C@H]3[C@H]4COC(=O)[C@@H]4[C@@H](C5=CC6=C(C=C35)OCO6)C7=CC(=C(C(=C7)OC)O)OC)O)O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/etoposide-vp-16.html |