Metaraminol Bitartrate
A sympathomimetic agent that acts predominantly at alpha-1 adrenergic receptors. It has been used primarily as a vasoconstrictor in the treatment of HYPOTENSION.
| Catalog Number | API33402038 |
| Alternative Name(s) | Metaraminol (+)-bitartrate salt Araminum Metaraminol Tartrate |
| Research Area | Antishock Vasoactive APIs |
| Molecular Formula | C13H19NO8 |
| CAS# | 33402-03-8 |
| SMILES | CC(C(C1=CC(=CC=C1)O)O)N.C(C(C(=O)O)O)(C(=O)O)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/metaraminol-bitartrate-item-5955.html |