LUF5834 | MedChemExpress (MCE)
LUF5834 is a selective A2B adenosine receptor (A2BR) partial agonist (EC50 = 12 nM). LUF5834 is also a partial A1/A2A adenosine receptor agonist (lacking selectivity) with Ki values of 2.6 and 28 nM, respectively[1][2].
| Trivial name | LUF5834 |
| Catalog Number | HY-103170 |
| Research Area | Others |
| CAS# | 333962-91-7 |
| Purity | ≥98.00% |
| SMILES | N#CC1=C(C2=CC=C(O)C=C2)C(C#N)=C(SCC3=NC=CN3)N=C1N |
| PubChem Chemical Structure ID | 135543624 |
| Size | 5 mg |
| Supplier Page | https://www.medchemexpress.com/luf5834.html |