Gartanin
Gartanin, a natural product isolated and purified from the stem bark of Garcinia mangostana, possesses antifungal, antioxidant, anti‑inflammatory and antineoplastic properties, can be a multiple targeting agent into its chemopreventive properties for human urinary bladder cancer, and induces protective autophagy mainly by JNK-Bcl-2 pathway.
| Trivial name | / |
| Catalog Number | CSN17081 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C23H24O6 |
| CAS# | 33390-42-0 |
| Purity | ≥98% |
| SMILES | CC(C)=CCC1=C(O)C(CC=C(C)C)=C2OC3=C(C(=O)C2=C1O)C(O)=CC=C3O |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/gartanin.html |