Telatinib (BAY 57-9352) 10mM * 1mL in DMSO
Telatinib (BAY 57-9352) is an orally available, small-molecule inhibitor of vascular endothelial growth factor receptors 2 and 3 (VEGFR-2/-3) and platelet-derived growth factor receptor ?? tyrosine kinases.
| Trivial name | Telatinib (BAY 57-9352) 10mM * 1mL in DMSO |
| Catalog Number | A10903-10mM-D |
| Alternative Name(s) | 4-[[[4-[(4-Chlorophenyl)amino]furo[2,3-d]pyridazin-7-yl]oxy]methyl]-N-methyl-2-pyridinecarboxamide |
| Molecular Formula | C20H16ClN5O3 |
| CAS# | 332012-40-5 |
| SMILES | CNC(=O)C1=NC=CC(=C1)COC2=NN=C(C3=C2OC=C3)NC4=CC=C(C=C4)Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/telatinib-bay-57-9352.html |