LLO (190-201) | MedChemExpress (MCE)
LLO (190-201) (Listeriolysin O 190 peptide) is a biological active peptide. (This peptide is a major histocompatibility complex class II (MHC-II)-restricted peptide, LLO190 (NEKYAQAYPNVS), from the listeriolysin O protein of Listeria monocytogenes, which generates an LLO190-specific Th response. This peptide subsequently challenge recombinant L. monocytogenes expressing the MHC-I-restricted epitope of ovalbumin (Ova257, SIINFEKL).)
| Trivial name | LLO (190-201) |
| Catalog Number | HY-P5412 |
| Alternative Name(s) | Listeriolysin O 190 peptide |
| Research Area | Others |
| CAS# | 331941-87-8 |
| Purity | ≥98.00% |
| SMILES | OC(C=C1)=CC=C1C[C@H](NC([C@H](C)NC([C@H](CCC(N)=O)NC([C@H](C)NC([C@@H](NC([C@H](CCCCN)NC([C@H](CCC(O)=O)NC([C@@H](N)CC(N)=O)=O)=O)=O)CC2=CC=C(C=C2)O)=O)=O)=O)=O)C(N3[C@@H](CCC3)C(N[C@@H](CC(N)=O)C(N[C@@H](C(C)C)C(N[C@@H](CO)C(O)=O)=O)=O)=O)=O |
| PubChem Chemical Structure ID | 168510716 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/llo-190-201.html |