ZM-447439 10mM * 1mL in DMSO
ZM-447439 is a potein, selective ATP-competitive Aurora B kinase inhibitor with an IC50 of 50 nM, 1 ??M and 250 nM for Aurora B, A and C, respectively.
| Trivial name | ZM-447439 10mM * 1mL in DMSO |
| Catalog Number | A11009-10mM-D |
| Alternative Name(s) | N-[4-[[6-Methoxy-7-[3-(4-morpholinyl)propoxy]-4-quinazolinyl]amino]phenyl]benzamide |
| Molecular Formula | C29H31N5O4 |
| CAS# | 331771-20-1 |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC=C(C=C3)NC(=O)C4=CC=CC=C4)OCCCN5CCOCC5 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/zm-447439.html |