LG 101506
RXR modulator Others|Retinoid X Receptors
| Catalog Number | B7414-10 |
| Research Area | Others|Retinoid X Receptors |
| Molecular Formula | C25H34F2O3 |
| CAS# | 331248-11-4 |
| Purity | 98% |
| SMILES | FC(COC(C(/C(C)=CC=CC(C)=CC(O)=O)=C1)=C(C=C1C(C)(C)C)C(C)(C)C)F |
| Size | 10mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B7414 |
