Caffeic Acid
Caffeic acid is a hydroxycinnamic acid, a naturally occurring organic compound isolated and purified from the herb of Boehmeria siamensis Craib., with antioxidant, antineoplastic, anti-HIV, choleretic, hepatotropic, and is a strong inhibitor of neutrophil elastase.
| Trivial name | / |
| Catalog Number | CSN10424 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C9H8O4 |
| CAS# | 331-39-5 |
| Purity | ≥99% |
| SMILES | O=C(O)/C=C/C1=CC=C(O)C(O)=C1 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/caffeic-acid.html |
