Caffeic Acid
Caffeic acid exists in its free and ester form. It is considered as the predominant polyphenol, contributing to the hydroxycinnamic acid content in various fruits. Coffee is one of the major source of caffeic acid.
| Catalog Number | CDC10-0037 |
| Alternative Name(s) | 3,4-Dihydroxybenzeneacrylic acid, 3,4-Dihydroxycinnamic acid, 3-(3,4-Dihydroxyphenyl)-2-propenoic acid |
| Research Area | Used for research and manufacturing |
| Molecular Formula | C9H8O4 |
| CAS# | 331-39-5 |
| Inchi | 1S/C9H8O4/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1-5,10-11H,(H,12,13)/b4-2+ |
| SMILES | OC(=O)\C=C\c1ccc(O)c(O)c1 |
| EC Number | 206-361-2 |
| Size | inquire |
| Supplier Page | https://www.formulationbio.com/caffeic-acid-item-2119.html |