Amitraz
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-11595 |
| Alternative Name(s) | N'-(2,4-Dimethylphenyl)-N-[[(2,4-dimethylphenyl)imino]methyl]-N-methyl-methanimidamide |
| Research Area | Amitraz is an antiparasitic used to control red spider mites, leaf miners and scale insects. This compound is active by inhibiting the targets monoaminooxidase enzyme. |
| Molecular Formula | C19H23N3 |
| CAS# | 33089-61-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CN(/C=N/C(C=CC(C)=C1)=C1C)/C=N/C(C=CC(C)=C2)=C2C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11595.html |
| Additional Information | NULL |